Difference between revisions of "4-PHOSPHONOOXY-THREONINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite VibB == * common-name: ** an apo-[vibb aryl-carrier protein] == Reaction(s) known to consume the compound == * RXN-10994 == Reaction(...") |
(Created page with "Category:metabolite == Metabolite 4-PHOSPHONOOXY-THREONINE == * common-name: ** 4-phosphooxy-l-threonine * molecular-weight: ** 213.083 * inchi-key: ** fkhakijokdgeii-gbxi...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 4-PHOSPHONOOXY-THREONINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-phosphooxy-l-threonine |
| + | * molecular-weight: | ||
| + | ** 213.083 | ||
| + | * inchi-key: | ||
| + | ** fkhakijokdgeii-gbxijsldsa-l | ||
| + | * smiles: | ||
| + | ** c(=o)([o-])c([n+])c(o)cop([o-])(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[PSERTRANSAMPYR-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[PSERTRANSAMPYR-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-phosphooxy-l-threonine}} |
| + | {{#set: molecular-weight=213.083}} | ||
| + | {{#set: inchi-key=inchikey=fkhakijokdgeii-gbxijsldsa-l}} | ||
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite 4-PHOSPHONOOXY-THREONINE
- common-name:
- 4-phosphooxy-l-threonine
- molecular-weight:
- 213.083
- inchi-key:
- fkhakijokdgeii-gbxijsldsa-l
- smiles:
- c(=o)([o-])c([n+])c(o)cop([o-])(=o)[o-]
