Difference between revisions of "4-hydroxybenzoate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole * molecular-weight: ** 294.18 * in...") |
(Created page with "Category:metabolite == Metabolite 4-hydroxybenzoate == * common-name: ** 4-hydroxybenzoate * molecular-weight: ** 137.115 * inchi-key: ** fjkrolugyxjwqn-uhfffaoysa-m * smi...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 4-hydroxybenzoate == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-hydroxybenzoate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 137.115 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fjkrolugyxjwqn-uhfffaoysa-m |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c1(c=cc(=cc=1)o))(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.5.1.39-RXN]] |
| + | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] | ||
| + | * [[RXN-11368]] | ||
| + | * [[RXN-9003]] | ||
| + | * [[RXN-9222]] | ||
| + | * [[RXN-9230]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-hydroxybenzoate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=137.115}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}} |
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite 4-hydroxybenzoate
- common-name:
- 4-hydroxybenzoate
- molecular-weight:
- 137.115
- inchi-key:
- fjkrolugyxjwqn-uhfffaoysa-m
- smiles:
- c(c1(c=cc(=cc=1)o))(=o)[o-]
