Difference between revisions of "5-DEHYDROGLUCONATE"

Revision as of 18:59, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite COPROPORPHYRINOGEN_I ==
+== Metabolite Long-chain-alcohols ==
 * common-name:
-** coproporphyrinogen i
+** a long-chain alcohol
-* molecular-weight:
-** 656.734
-* inchi-key:
-** wiuggjkhyqignh-uhfffaoysa-j
-* smiles:
-** cc1(=c2(cc5(=c(ccc([o-])=o)c(c)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc([o-])=o)c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
 == Reaction(s) known to consume the compound ==
+* [[ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10642]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=coproporphyrinogen i}}
+{{#set: common-name=a long-chain alcohol}}
-{{#set: molecular-weight=656.734}}
-{{#set: inchi-key=inchikey=wiuggjkhyqignh-uhfffaoysa-j}}