Difference between revisions of "5-DIPHOSPHO-1D-MYO-INOSITOL-12346P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-24184 == == Reaction(s) known to consume the compound == * RXN-22206 == Reaction(s) known to produce the compound == == Reaction(...")
(Created page with "Category:metabolite == Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P == * common-name: ** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate * molecular-weight: ** 7...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-24184 ==
+
== Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P ==
 +
* common-name:
 +
** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate
 +
* molecular-weight:
 +
** 726.913
 +
* inchi-key:
 +
** uphpwxpnziozjl-kxxvrosksa-a
 +
* smiles:
 +
** c1(op([o-])([o-])=o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-22206]]
+
* [[2.7.4.24-RXN]]
 +
* [[RXN-10979]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.1.152-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate}}
 +
{{#set: molecular-weight=726.913}}
 +
{{#set: inchi-key=inchikey=uphpwxpnziozjl-kxxvrosksa-a}}

Latest revision as of 19:34, 17 March 2021

Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P

  • common-name:
    • 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate
  • molecular-weight:
    • 726.913
  • inchi-key:
    • uphpwxpnziozjl-kxxvrosksa-a
  • smiles:
    • c1(op([o-])([o-])=o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality