Difference between revisions of "5-L-GLUTAMYL-AMINO-ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C == * common-name: ** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * molecular-weight: ** 519.295 * inchi-...")
 
(Created page with "Category:metabolite == Metabolite CPD-15655 == * common-name: ** (3e)-undec-3-enoyl-coa * molecular-weight: ** 929.765 * inchi-key: ** hvxccjiyxizgop-nadloitosa-j * smiles...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C ==
+
== Metabolite CPD-15655 ==
 
* common-name:
 
* common-name:
** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
+
** (3e)-undec-3-enoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 519.295
+
** 929.765
 
* inchi-key:
 
* inchi-key:
** yfaukwznpvbcff-xhibxcghsa-l
+
** hvxccjiyxizgop-nadloitosa-j
 
* smiles:
 
* smiles:
** cc(o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
+
** cccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.148-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.60-RXN]]
+
* [[RXN-14776]]
 +
* [[RXN-14790]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
+
{{#set: common-name=(3e)-undec-3-enoyl-coa}}
{{#set: molecular-weight=519.295}}
+
{{#set: molecular-weight=929.765}}
{{#set: inchi-key=inchikey=yfaukwznpvbcff-xhibxcghsa-l}}
+
{{#set: inchi-key=inchikey=hvxccjiyxizgop-nadloitosa-j}}

Revision as of 17:53, 13 January 2021

Metabolite CPD-15655

  • common-name:
    • (3e)-undec-3-enoyl-coa
  • molecular-weight:
    • 929.765
  • inchi-key:
    • hvxccjiyxizgop-nadloitosa-j
  • smiles:
    • cccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality