Difference between revisions of "5-L-GLUTAMYL-AMINO-ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-CYSTATHIONINE == * common-name: ** l-cystathionine * molecular-weight: ** 222.259 * inchi-key: ** ilrylpwnyfxemh-whfbiakzsa-n * smiles:...")
(Created page with "Category:metabolite == Metabolite Protein-pi-phospho-L-histidines == * common-name: ** a [protein]-nπ-phospho-l-histidine == Reaction(s) known to consume the compound =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-CYSTATHIONINE ==
+
== Metabolite Protein-pi-phospho-L-histidines ==
 
* common-name:
 
* common-name:
** l-cystathionine
+
** a [protein]-nπ-phospho-l-histidine
* molecular-weight:
 
** 222.259
 
* inchi-key:
 
** ilrylpwnyfxemh-whfbiakzsa-n
 
* smiles:
 
** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYSTATHIONASE-RXN]]
+
* [[RXN-15509]]
* [[CYSTATHIONINE-BETA-LYASE-RXN]]
+
* [[RXN-15510]]
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+
* [[RXN-15511]]
* [[O-SUCCHOMOSERLYASE-RXN]]
+
* [[RXN-15512]]
* [[RXN-14048]]
 
* [[RXN-15130]]
 
* [[RXN-15131]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CYSPH-RXN]]
+
* [[RXN-15509]]
* [[CYSTATHIONASE-RXN]]
+
* [[RXN-15510]]
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+
* [[RXN-15511]]
* [[O-SUCCHOMOSERLYASE-RXN]]
+
* [[RXN-15512]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-cystathionine}}
+
{{#set: common-name=a [protein]-nπ-phospho-l-histidine}}
{{#set: molecular-weight=222.259}}
 
{{#set: inchi-key=inchikey=ilrylpwnyfxemh-whfbiakzsa-n}}
 

Revision as of 19:01, 17 March 2021

Metabolite Protein-pi-phospho-L-histidines

  • common-name:
    • a [protein]-nπ-phospho-l-histidine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-nπ-phospho-l-histidine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.