Difference between revisions of "5-L-GLUTAMYL-AMINO-ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15655 == * common-name: ** (3e)-undec-3-enoyl-coa * molecular-weight: ** 929.765 * inchi-key: ** hvxccjiyxizgop-nadloitosa-j * smiles...")
(Created page with "Category:metabolite == Metabolite 5-L-GLUTAMYL-AMINO-ACID == * common-name: ** an α-(5-l-glutamyl)-amino acid == Reaction(s) known to consume the compound == == Reac...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-15655 ==
+
== Metabolite 5-L-GLUTAMYL-AMINO-ACID ==
 
* common-name:
 
* common-name:
−
** (3e)-undec-3-enoyl-coa
+
** an α-(5-l-glutamyl)-amino acid
−
* molecular-weight:
 
−
** 929.765
 
−
* inchi-key:
 
−
** hvxccjiyxizgop-nadloitosa-j
 
−
* smiles:
 
−
** cccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-14776]]
+
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
−
* [[RXN-14790]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(3e)-undec-3-enoyl-coa}}
+
{{#set: common-name=an α-(5-l-glutamyl)-amino acid}}
−
{{#set: molecular-weight=929.765}}
 
−
{{#set: inchi-key=inchikey=hvxccjiyxizgop-nadloitosa-j}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite 5-L-GLUTAMYL-AMINO-ACID

  • common-name:
    • an α-(5-l-glutamyl)-amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=5-L-GLUTAMYL-AMINO-ACID&oldid=49180"