Difference between revisions of "5-L-GLUTAMYL-AMINO-ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C == * common-name: ** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * molecular-weight: ** 519.295 * inchi-...")
 
(Created page with "Category:metabolite == Metabolite 5-L-GLUTAMYL-AMINO-ACID == * common-name: ** an α-(5-l-glutamyl)-amino acid == Reaction(s) known to consume the compound == == Reac...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C ==
+
== Metabolite 5-L-GLUTAMYL-AMINO-ACID ==
 
* common-name:
 
* common-name:
−
** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
+
** an α-(5-l-glutamyl)-amino acid
−
* molecular-weight:
 
−
** 519.295
 
−
* inchi-key:
 
−
** yfaukwznpvbcff-xhibxcghsa-l
 
−
* smiles:
 
−
** cc(o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[2.7.1.148-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[2.7.7.60-RXN]]
+
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
+
{{#set: common-name=an α-(5-l-glutamyl)-amino acid}}
−
{{#set: molecular-weight=519.295}}
 
−
{{#set: inchi-key=inchikey=yfaukwznpvbcff-xhibxcghsa-l}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite 5-L-GLUTAMYL-AMINO-ACID

  • common-name:
    • an α-(5-l-glutamyl)-amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=5-L-GLUTAMYL-AMINO-ACID&oldid=49180"