Difference between revisions of "5-METHYLTHIOADENOSINE"

Latest revision as of 19:35, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite 5-HYDROXY-TRYPTOPHAN ==
+== Metabolite 5-METHYLTHIOADENOSINE ==
 * common-name:
-** 5-hydroxy-l-tryptophan
+** s-methyl-5'-thioadenosine
 * molecular-weight:
-** 220.227
+** 297.331
 * inchi-key:
-** ldcyzajdbxycgn-vifpvbqesa-n
+** wuugfsxjnotrmr-ioslpcccsa-n
 * smiles:
-** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+]))
+** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
 == Reaction(s) known to consume the compound ==
-* [[RXN3DJ-170]]
+* [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]]
+* [[RXN-11190]]
+* [[SPERMIDINESYN-RXN]]
 == Reaction(s) known to produce the compound ==
+* [[4.4.1.14-RXN]]
+* [[RXN-11190]]
+* [[RXN0-5217]]
+* [[SPERMIDINESYN-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=5-hydroxy-l-tryptophan}}
+{{#set: common-name=s-methyl-5'-thioadenosine}}
-{{#set: molecular-weight=220.227}}
+{{#set: molecular-weight=297.331}}
-{{#set: inchi-key=inchikey=ldcyzajdbxycgn-vifpvbqesa-n}}
+{{#set: inchi-key=inchikey=wuugfsxjnotrmr-ioslpcccsa-n}}