Difference between revisions of "5-METHYLTHIOADENOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BENZALDEHYDE == * common-name: ** benzaldehyde * molecular-weight: ** 106.124 * inchi-key: ** humnylrzrppjdn-uhfffaoysa-n * smiles: ** c(...") |
(Created page with "Category:metabolite == Metabolite 5-METHYLTHIOADENOSINE == * common-name: ** s-methyl-5'-thioadenosine * molecular-weight: ** 297.331 * inchi-key: ** wuugfsxjnotrmr-ioslpc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-METHYLTHIOADENOSINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-methyl-5'-thioadenosine |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 297.331 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wuugfsxjnotrmr-ioslpcccsa-n |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]] | ||
| + | * [[RXN-11190]] | ||
| + | * [[SPERMIDINESYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[4.4.1.14-RXN]] |
| + | * [[RXN-11190]] | ||
| + | * [[RXN0-5217]] | ||
| + | * [[SPERMIDINESYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-methyl-5'-thioadenosine}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=297.331}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wuugfsxjnotrmr-ioslpcccsa-n}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite 5-METHYLTHIOADENOSINE
- common-name:
- s-methyl-5'-thioadenosine
- molecular-weight:
- 297.331
- inchi-key:
- wuugfsxjnotrmr-ioslpcccsa-n
- smiles:
- cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
