Difference between revisions of "5-Phospho-terminated-DNAs"

Revision as of 17:53, 13 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite DIMP ==
+== Metabolite CDP ==
 * common-name:
-** dimp
+** cdp
 * molecular-weight:
-** 330.193
+** 400.155
 * inchi-key:
-** phngfppxdjjadg-rrkcrqdmsa-l
+** zwiadyzpowuwew-xvfcmesisa-k
 * smiles:
-** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
+** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
 == Reaction(s) known to consume the compound ==
+* [[CDPKIN-RXN]]
+* [[CDPREDUCT-RXN]]
+* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
+* [[RXN-11832]]
+* [[RXN-12198]]
 == Reaction(s) known to produce the compound ==
-* [[RXN0-1602]]
+* [[DOLICHOL-KINASE-RXN]]
+* [[RXN-11832]]
+* [[RXN-12195]]
+* [[RXN-12959]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=dimp}}
+{{#set: common-name=cdp}}
-{{#set: molecular-weight=330.193}}
+{{#set: molecular-weight=400.155}}
-{{#set: inchi-key=inchikey=phngfppxdjjadg-rrkcrqdmsa-l}}
+{{#set: inchi-key=inchikey=zwiadyzpowuwew-xvfcmesisa-k}}