Difference between revisions of "5-Phospho-terminated-DNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CDP == * common-name: ** cdp * molecular-weight: ** 400.155 * inchi-key: ** zwiadyzpowuwew-xvfcmesisa-k * smiles: ** c(c2(c(c(c(n1(c(n=c(...") |
(Created page with "Category:metabolite == Metabolite 3-P-HYDROXYPYRUVATE == * common-name: ** 3-phosphooxypyruvate * molecular-weight: ** 181.018 * inchi-key: ** lflucdosqpjjbe-uhfffaoysa-k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-P-HYDROXYPYRUVATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-phosphooxypyruvate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 181.018 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lflucdosqpjjbe-uhfffaoysa-k |
* smiles: | * smiles: | ||
| − | ** c | + | ** c(op([o-])(=o)[o-])c(=o)c(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PGLYCDEHYDROG-RXN]] |
| − | * [[ | + | * [[PSERTRANSAM-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PGLYCDEHYDROG-RXN]] |
| − | * [[ | + | * [[PSERTRANSAM-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-phosphooxypyruvate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=181.018}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lflucdosqpjjbe-uhfffaoysa-k}} |
Revision as of 15:08, 15 March 2021
Contents
Metabolite 3-P-HYDROXYPYRUVATE
- common-name:
- 3-phosphooxypyruvate
- molecular-weight:
- 181.018
- inchi-key:
- lflucdosqpjjbe-uhfffaoysa-k
- smiles:
- c(op([o-])(=o)[o-])c(=o)c(=o)[o-]
