Difference between revisions of "5Z8Z11Z14Z17Z-EICOSAPENTAENOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12377 == * common-name: ** hydroxyl radical * molecular-weight: ** 17.007 * inchi-key: ** tujkjamukrirhc-uhfffaoysa-n * smiles: ** o...") |
(Created page with "Category:metabolite == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == * common-name: ** (5z,8z,11z,14z,17z)-icosapentaenoate * molecular-weight: ** 301.448 * inchi-key: **...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (5z,8z,11z,14z,17z)-icosapentaenoate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 301.448 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jazbehyotptenj-jlnkqsitsa-m |
* smiles: | * smiles: | ||
| − | ** o | + | ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12978]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13431]] |
| + | * [[RXN-16139]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(5z,8z,11z,14z,17z)-icosapentaenoate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=301.448}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jazbehyotptenj-jlnkqsitsa-m}} |
Latest revision as of 19:32, 17 March 2021
Contents
Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE
- common-name:
- (5z,8z,11z,14z,17z)-icosapentaenoate
- molecular-weight:
- 301.448
- inchi-key:
- jazbehyotptenj-jlnkqsitsa-m
- smiles:
- ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-]
