Difference between revisions of "7Z-hexadec-7-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CMP == * common-name: ** cmp * molecular-weight: ** 321.183 * inchi-key: ** ierhlvcpsmictf-xvfcmesisa-l * smiles: ** c(c2(c(c(c(n1(c(n=c(...")
 
(Created page with "Category:metabolite == Metabolite GALACTOSYLCERAMIDE-SULFATE == * common-name: ** a sulfatide == Reaction(s) known to consume the compound == == Reaction(s) known to produ...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CMP ==
+
== Metabolite GALACTOSYLCERAMIDE-SULFATE ==
 
* common-name:
 
* common-name:
** cmp
+
** a sulfatide
* molecular-weight:
 
** 321.183
 
* inchi-key:
 
** ierhlvcpsmictf-xvfcmesisa-l
 
* smiles:
 
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11832]]
 
* [[RXN-14026]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.99.6-RXN]]
+
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
* [[2.7.8.11-RXN]]
 
* [[2.7.8.24-RXN]]
 
* [[CYTIKIN-RXN]]
 
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
 
* [[PHOSPHAGLYPSYN-RXN]]
 
* [[RXN-11832]]
 
* [[RXN-12198]]
 
* [[RXN-12200]]
 
* [[RXN-15271]]
 
* [[RXN0-302]]
 
* [[RXN0-383]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cmp}}
+
{{#set: common-name=a sulfatide}}
{{#set: molecular-weight=321.183}}
 
{{#set: inchi-key=inchikey=ierhlvcpsmictf-xvfcmesisa-l}}
 

Revision as of 17:56, 13 January 2021

Metabolite GALACTOSYLCERAMIDE-SULFATE

  • common-name:
    • a sulfatide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality