Difference between revisions of "A-pyruvate-dehydrogenase-E2-protein-Nsup"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4201 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate * molecular-weight: ** 572.278 * inchi-key: ** oplvztyv...")
 
(Created page with "Category:metabolite == Metabolite a-pyruvate-dehydrogenase-E2-protein-Nsup == * common-name: ** a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine == Reaction(s) k...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-4201 ==
+
== Metabolite a-pyruvate-dehydrogenase-E2-protein-Nsup ==
 
* common-name:
 
* common-name:
−
** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate
+
** a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine
−
* molecular-weight:
 
−
** 572.278
 
−
* inchi-key:
 
−
** oplvztyvquwkhb-sdbhatresa-k
 
−
* smiles:
 
−
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14957]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-4303]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-triphosphate}}
+
{{#set: common-name=a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine}}
−
{{#set: molecular-weight=572.278}}
 
−
{{#set: inchi-key=inchikey=oplvztyvquwkhb-sdbhatresa-k}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite a-pyruvate-dehydrogenase-E2-protein-Nsup

  • common-name:
    • a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=A-pyruvate-dehydrogenase-E2-protein-Nsup&oldid=48503"