Difference between revisions of "ACETALD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHE == * common-name: ** l-phenylalanine * molecular-weight: ** 165.191 * inchi-key: ** colnvldhvkwlrt-qmmmgpobsa-n * smiles: ** c([o-])(...")
(Created page with "Category:metabolite == Metabolite 2-4-2-N-linked-Glycan == * common_name: ** [(2),(4),(2)]-n-linked glycan == Reaction(s) known to consume the compound == == Reaction(s) k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHE ==
+
== Metabolite 2-4-2-N-linked-Glycan ==
* common-name:
+
* common_name:
** l-phenylalanine
+
** [(2),(4),(2)]-n-linked glycan
* molecular-weight:
 
** 165.191
 
* inchi-key:
 
** colnvldhvkwlrt-qmmmgpobsa-n
 
* smiles:
 
** c([o-])(=o)c([n+])cc1(c=cc=cc=1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.58-RXN]]
 
* [[PHEAMINOTRANS-RXN]]
 
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
 
* [[RXN-10814]]
 
* [[RXN-17130]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.58-RXN]]
+
* [[2.4.1.144-RXN]]
* [[CARBOXYCYCLOHEXADIENYL-DEHYDRATASE-RXN]]
 
* [[PHEAMINOTRANS-RXN]]
 
* [[RXN-10814]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-phenylalanine}}
+
{{#set: common_name=[(2),(4),(2)]-n-linked glycan}}
{{#set: molecular-weight=165.191}}
 
{{#set: inchi-key=inchikey=colnvldhvkwlrt-qmmmgpobsa-n}}
 

Revision as of 15:09, 15 March 2021

Metabolite 2-4-2-N-linked-Glycan

  • common_name:
    • [(2),(4),(2)]-n-linked glycan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common name" (as page type) with input value "(2),(4),(2)]-n-linked glycan" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.