Difference between revisions of "ACETYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7993 == * common-name: ** n-methylaminobutanal * molecular-weight: ** 102.156 * inchi-key: ** pjzbkcvvfptfaw-uhfffaoysa-o * smiles: *...")
(Created page with "Category:metabolite == Metabolite ACETYL-COA == * common-name: ** acetyl-coa * molecular-weight: ** 805.54 * inchi-key: ** zslzbfcdcinbpy-zsjpkinusa-j * smiles: ** cc(=o)s...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7993 ==
+
== Metabolite ACETYL-COA ==
 
* common-name:
 
* common-name:
** n-methylaminobutanal
+
** acetyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 102.156
+
** 805.54
 
* inchi-key:
 
* inchi-key:
** pjzbkcvvfptfaw-uhfffaoysa-o
+
** zslzbfcdcinbpy-zsjpkinusa-j
 
* smiles:
 
* smiles:
** c[n+]cccc=o
+
** cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8246]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.2.1.18-RXN]]
 +
* [[2-ISOPROPYLMALATESYN-RXN]]
 +
* [[2.3.1.67-RXN]]
 +
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 +
* [[CITSYN-RXN]]
 +
* [[DIHYDLIPACETRANS-RXN]]
 +
* [[FATTY-ACID-SYNTHASE-RXN]]
 +
* [[GLUCOSAMINEPNACETYLTRANS-RXN]]
 +
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
* [[MALSYN-RXN]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 +
* [[PEPTIDE-ALPHA-N-ACETYLTRANSFERASE-RXN]]
 +
* [[RXN-12565]]
 +
* [[RXN-13431]]
 +
* [[RXN-16016]]
 +
* [[RXN-5181]]
 +
* [[RXN-8032]]
 +
* [[RXN0-5055]]
 +
* [[RXN0-6948]]
 +
* [[SERINE-O-ACETTRAN-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8244]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.2.1.18-RXN]]
 +
* [[2.3.1.155-RXN]]
 +
* [[2.3.1.67-RXN]]
 +
* [[ACETATE--COA-LIGASE-RXN]]
 +
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 +
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
* [[KETOACYLCOATHIOL-RXN]]
 +
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 +
* [[PEPTIDE-ALPHA-N-ACETYLTRANSFERASE-RXN]]
 +
* [[PYRUVDEH-RXN]]
 +
* [[R7-RXN]]
 +
* [[RXN-10699]]
 +
* [[RXN-10700]]
 +
* [[RXN-10701]]
 +
* [[RXN-11246]]
 +
* [[RXN-11917]]
 +
* [[RXN-11921]]
 +
* [[RXN-12561]]
 +
* [[RXN-12565]]
 +
* [[RXN-12710]]
 +
* [[RXN-13617]]
 +
* [[RXN-14268]]
 +
* [[RXN-14274]]
 +
* [[RXN-14277]]
 +
* [[RXN-14394]]
 +
* [[RXN-14774]]
 +
* [[RXN-14788]]
 +
* [[RXN-14793]]
 +
* [[RXN-14799]]
 +
* [[RXN-14803]]
 +
* [[RXN-16137]]
 +
* [[RXN-16561]]
 +
* [[RXN-17116]]
 +
* [[RXN-17778]]
 +
* [[RXN-17782]]
 +
* [[RXN-17787]]
 +
* [[RXN-17791]]
 +
* [[RXN-17795]]
 +
* [[RXN-17799]]
 +
* [[RXN-2006]]
 +
* [[RXN-2902]]
 +
* [[RXN-5181]]
 +
* [[RXN-8032]]
 +
* [[RXN-9958]]
 +
* [[RXN0-1133]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-methylaminobutanal}}
+
{{#set: common-name=acetyl-coa}}
{{#set: molecular-weight=102.156}}
+
{{#set: molecular-weight=805.54}}
{{#set: inchi-key=inchikey=pjzbkcvvfptfaw-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=zslzbfcdcinbpy-zsjpkinusa-j}}

Latest revision as of 19:33, 17 March 2021

Metabolite ACETYL-COA

  • common-name:
    • acetyl-coa
  • molecular-weight:
    • 805.54
  • inchi-key:
    • zslzbfcdcinbpy-zsjpkinusa-j
  • smiles:
    • cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality