Difference between revisions of "ACP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Methylated-MtmC-Proteins == * common-name: ** a [methyl-co(iii) methylamine-specific corrinoid protein] == Reaction(s) known to consume t...") |
(Created page with "Category:metabolite == Metabolite 2-PROTOCATECHUOYLPHLOROGLUCINOLCARBOXYLA == * common-name: ** 2-protocatechuoylphloroglucinolcarboxylate * molecular-weight: ** 305.22 *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-PROTOCATECHUOYLPHLOROGLUCINOLCARBOXYLA == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-protocatechuoylphloroglucinolcarboxylate |
| + | * molecular-weight: | ||
| + | ** 305.22 | ||
| + | * inchi-key: | ||
| + | ** grxielrcpyieqi-uhfffaoysa-m | ||
| + | * smiles: | ||
| + | ** c(c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(=c(c=2)o)o))=o))([o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[QUERCETIN-23-DIOXYGENASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-protocatechuoylphloroglucinolcarboxylate}} |
| + | {{#set: molecular-weight=305.22}} | ||
| + | {{#set: inchi-key=inchikey=grxielrcpyieqi-uhfffaoysa-m}} | ||
Revision as of 17:52, 13 January 2021
Contents
Metabolite 2-PROTOCATECHUOYLPHLOROGLUCINOLCARBOXYLA
- common-name:
- 2-protocatechuoylphloroglucinolcarboxylate
- molecular-weight:
- 305.22
- inchi-key:
- grxielrcpyieqi-uhfffaoysa-m
- smiles:
- c(c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(=c(c=2)o)o))=o))([o-])=o
