Difference between revisions of "ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13575 == * common-name: ** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate * molecular-weight: ** 264.169 * inchi-...")
(Created page with "Category:metabolite == Metabolite CPD-4143 == * common-name: ** sitosterol * molecular-weight: ** 414.713 * inchi-key: ** kzjwdpnrjallns-vjsfxxlfsa-n * smiles: ** ccc(c(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13575 ==
+
== Metabolite CPD-4143 ==
 
* common-name:
 
* common-name:
** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate
+
** sitosterol
 
* molecular-weight:
 
* molecular-weight:
** 264.169
+
** 414.713
 
* inchi-key:
 
* inchi-key:
** pqmcqnovnfnpfj-hyimlasbsa-k
+
** kzjwdpnrjallns-vjsfxxlfsa-n
 
* smiles:
 
* smiles:
** cc1(c(=ccop([o-])(=o)[o-])sc(c(=o)[o-])n=1)
+
** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12611]]
+
* [[RXN-12128]]
 +
* [[RXN-12789]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12789]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate}}
+
{{#set: common-name=sitosterol}}
{{#set: molecular-weight=264.169}}
+
{{#set: molecular-weight=414.713}}
{{#set: inchi-key=inchikey=pqmcqnovnfnpfj-hyimlasbsa-k}}
+
{{#set: inchi-key=inchikey=kzjwdpnrjallns-vjsfxxlfsa-n}}

Revision as of 19:00, 17 March 2021

Metabolite CPD-4143

  • common-name:
    • sitosterol
  • molecular-weight:
    • 414.713
  • inchi-key:
    • kzjwdpnrjallns-vjsfxxlfsa-n
  • smiles:
    • ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality