Difference between revisions of "ACYL-ACP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CARBAMOYL-P == * common-name: ** carbamoyl phosphate * molecular-weight: ** 139.004 * inchi-key: ** ffqkyprqeygkaf-uhfffaoysa-l * smiles:...") |
(Created page with "Category:metabolite == Metabolite CPD-11552 == * common-name: ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate * molecular-weight: ** 222.177 * inchi-key: ** ycjnyhccoxvy...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11552 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 222.177 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ycjnyhccoxvyaf-uhfffaoysa-m |
* smiles: | * smiles: | ||
| − | ** c(=o)( | + | ** c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-10721]] | |
| − | + | * [[RXN-10722]] | |
| − | * [[RXN- | ||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-10721]] | |
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=222.177}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ycjnyhccoxvyaf-uhfffaoysa-m}} |
Revision as of 17:49, 13 January 2021
Contents
Metabolite CPD-11552
- common-name:
- 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
- molecular-weight:
- 222.177
- inchi-key:
- ycjnyhccoxvyaf-uhfffaoysa-m
- smiles:
- c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1)
