Difference between revisions of "ACYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11552 == * common-name: ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate * molecular-weight: ** 222.177 * inchi-key: ** ycjnyhccoxvy...")
(Created page with "Category:metabolite == Metabolite Long-Chain-Aldehydes == * common-name: ** a long-chain aldehyde == Reaction(s) known to consume the compound == == Reaction(s) known to p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11552 ==
+
== Metabolite Long-Chain-Aldehydes ==
 
* common-name:
 
* common-name:
** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
+
** a long-chain aldehyde
* molecular-weight:
 
** 222.177
 
* inchi-key:
 
** ycjnyhccoxvyaf-uhfffaoysa-m
 
* smiles:
 
** c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10721]]
 
* [[RXN-10722]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10721]]
+
* [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
 +
* [[RXN-17107]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}}
+
{{#set: common-name=a long-chain aldehyde}}
{{#set: molecular-weight=222.177}}
 
{{#set: inchi-key=inchikey=ycjnyhccoxvyaf-uhfffaoysa-m}}
 

Revision as of 15:05, 15 March 2021

Metabolite Long-Chain-Aldehydes

  • common-name:
    • a long-chain aldehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality