Difference between revisions of "ADENINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PRO-tRNAs == * common-name: ** a trnapro == Reaction(s) known to consume the compound == * PROLINE--TRNA-LIGASE-RXN == Reaction(s) kn...") |
(Created page with "Category:metabolite == Metabolite 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP == * common-name: ** 2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate * molecular-weigh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate |
| + | * molecular-weight: | ||
| + | ** 239.159 | ||
| + | * inchi-key: | ||
| + | ** yiemfvncenfbsd-xqrvvysfsa-k | ||
| + | * smiles: | ||
| + | ** csccc(c([o-])=cop([o-])(=o)[o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[R83-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[R82-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate}} |
| + | {{#set: molecular-weight=239.159}} | ||
| + | {{#set: inchi-key=inchikey=yiemfvncenfbsd-xqrvvysfsa-k}} | ||
Revision as of 19:03, 17 March 2021
Contents
Metabolite 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP
- common-name:
- 2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate
- molecular-weight:
- 239.159
- inchi-key:
- yiemfvncenfbsd-xqrvvysfsa-k
- smiles:
- csccc(c([o-])=cop([o-])(=o)[o-])=o
