Difference between revisions of "ADENINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP == * common-name: ** 2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate * molecular-weigh...")
(Created page with "Category:metabolite == Metabolite ADENINE == * common-name: ** adenine * molecular-weight: ** 135.128 * inchi-key: ** gffgjbxgbjisgv-uhfffaoysa-n * smiles: ** c1(n)(n=cn=c...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP ==
+
== Metabolite ADENINE ==
 
* common-name:
 
* common-name:
** 2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate
+
** adenine
 
* molecular-weight:
 
* molecular-weight:
** 239.159
+
** 135.128
 
* inchi-key:
 
* inchi-key:
** yiemfvncenfbsd-xqrvvysfsa-k
+
** gffgjbxgbjisgv-uhfffaoysa-n
 
* smiles:
 
* smiles:
** csccc(c([o-])=cop([o-])(=o)[o-])=o
+
** c1(n)(n=cn=c2(nc=nc=12))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R83-RXN]]
+
* [[ADENPRIBOSYLTRAN-RXN]]
 +
* [[RXN-15139]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R82-RXN]]
+
* [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate}}
+
{{#set: common-name=adenine}}
{{#set: molecular-weight=239.159}}
+
{{#set: molecular-weight=135.128}}
{{#set: inchi-key=inchikey=yiemfvncenfbsd-xqrvvysfsa-k}}
+
{{#set: inchi-key=inchikey=gffgjbxgbjisgv-uhfffaoysa-n}}

Latest revision as of 19:36, 17 March 2021

Metabolite ADENINE

  • common-name:
    • adenine
  • molecular-weight:
    • 135.128
  • inchi-key:
    • gffgjbxgbjisgv-uhfffaoysa-n
  • smiles:
    • c1(n)(n=cn=c2(nc=nc=12))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality