Difference between revisions of "ADENOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FRUCTOSE-16-DIPHOSPHATE == * common-name: ** β-d-fructose 1,6-bisphosphate * molecular-weight: ** 336.085 * inchi-key: ** rnbgygvwrk...")
(Created page with "Category:metabolite == Metabolite ADENOSINE == * common-name: ** adenosine * molecular-weight: ** 267.244 * inchi-key: ** oirdtqyftabqoq-kqynxxcusa-n * smiles: ** c(o)c1(o...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FRUCTOSE-16-DIPHOSPHATE ==
+
== Metabolite ADENOSINE ==
 
* common-name:
 
* common-name:
** β-d-fructose 1,6-bisphosphate
+
** adenosine
 
* molecular-weight:
 
* molecular-weight:
** 336.085
+
** 267.244
 
* inchi-key:
 
* inchi-key:
** rnbgygvwrkecfj-arqdhwqxsa-j
+
** oirdtqyftabqoq-kqynxxcusa-n
 
* smiles:
 
* smiles:
** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-]
+
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.90-RXN]]
+
* [[ADENODEAMIN-RXN]]
* [[F16ALDOLASE-RXN]]
+
* [[ADENOSINE-KINASE-RXN]]
* [[F16BDEPHOS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.90-RXN]]
+
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
* [[6PFRUCTPHOS-RXN]]
+
* [[AMP-DEPHOSPHORYLATION-RXN]]
* [[F16ALDOLASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-fructose 1,6-bisphosphate}}
+
{{#set: common-name=adenosine}}
{{#set: molecular-weight=336.085}}
+
{{#set: molecular-weight=267.244}}
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-arqdhwqxsa-j}}
+
{{#set: inchi-key=inchikey=oirdtqyftabqoq-kqynxxcusa-n}}

Latest revision as of 19:33, 17 March 2021

Metabolite ADENOSINE

  • common-name:
    • adenosine
  • molecular-weight:
    • 267.244
  • inchi-key:
    • oirdtqyftabqoq-kqynxxcusa-n
  • smiles:
    • c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality