Difference between revisions of "ADENOSINE DIPHOSPHATE RIBOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5441 == * common-name: ** n-dimethylethanolamine phosphate * molecular-weight: ** 168.109 * inchi-key: ** blhvjaaehmlmoi-uhfffaoysa-m...") |
(Created page with "Category:metabolite == Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE == * common-name: ** adp-d-ribose * molecular-weight: ** 557.303 * inchi-key: ** srnwougrcwsemx-tyasjmozsa-l...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** adp-d-ribose |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 557.303 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** srnwougrcwsemx-tyasjmozsa-l |
* smiles: | * smiles: | ||
| − | ** c | + | ** c(op(op([o-])(=o)occ1(c(o)c(o)c(o1)o))(=o)[o-])c4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-1441]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10034]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=adp-d-ribose}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=557.303}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=srnwougrcwsemx-tyasjmozsa-l}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE
- common-name:
- adp-d-ribose
- molecular-weight:
- 557.303
- inchi-key:
- srnwougrcwsemx-tyasjmozsa-l
- smiles:
- c(op(op([o-])(=o)occ1(c(o)c(o)c(o1)o))(=o)[o-])c4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o)
