Difference between revisions of "ADENOSYL-HOMO-CYS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1905 == * common-name: ** 8-oxo-dgtp * molecular-weight: ** 519.151 * inchi-key: ** buzogvvqwcxxdp-vpeninkcsa-j * smiles: ** c(op(=o...")
 
(Created page with "Category:metabolite == Metabolite CPD-19172 == * common-name: ** (2e,9z)-octadecenoyl-coa * molecular-weight: ** 1025.937 * inchi-key: ** reoymonhghuley-ppsvnwdxsa-j * smi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1905 ==
+
== Metabolite CPD-19172 ==
 
* common-name:
 
* common-name:
** 8-oxo-dgtp
+
** (2e,9z)-octadecenoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 519.151
+
** 1025.937
 
* inchi-key:
 
* inchi-key:
** buzogvvqwcxxdp-vpeninkcsa-j
+
** reoymonhghuley-ppsvnwdxsa-j
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
+
** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17776]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11410]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8-oxo-dgtp}}
+
{{#set: common-name=(2e,9z)-octadecenoyl-coa}}
{{#set: molecular-weight=519.151}}
+
{{#set: molecular-weight=1025.937}}
{{#set: inchi-key=inchikey=buzogvvqwcxxdp-vpeninkcsa-j}}
+
{{#set: inchi-key=inchikey=reoymonhghuley-ppsvnwdxsa-j}}

Revision as of 17:58, 13 January 2021

Metabolite CPD-19172

  • common-name:
    • (2e,9z)-octadecenoyl-coa
  • molecular-weight:
    • 1025.937
  • inchi-key:
    • reoymonhghuley-ppsvnwdxsa-j
  • smiles:
    • ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality