Difference between revisions of "ADENOSYLCOBINAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15667 == * common-name: ** 6-cis, 3-oxo-tridecenoyl-coa * molecular-weight: ** 971.802 * inchi-key: ** fdxhxlpclxeysu-dxazuofzsa-j *...")
 
(Created page with "Category:metabolite == Metabolite cis-delta7-3-hydroxycerotoyl-ACPs == * common-name: ** a (3r,7z)-3-hydroxyhexacos-7-enoyl-[acp] == Reaction(s) known to consume the compo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15667 ==
+
== Metabolite cis-delta7-3-hydroxycerotoyl-ACPs ==
 
* common-name:
 
* common-name:
** 6-cis, 3-oxo-tridecenoyl-coa
+
** a (3r,7z)-3-hydroxyhexacos-7-enoyl-[acp]
* molecular-weight:
 
** 971.802
 
* inchi-key:
 
** fdxhxlpclxeysu-dxazuofzsa-j
 
* smiles:
 
** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14774]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1G-364]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-cis, 3-oxo-tridecenoyl-coa}}
+
{{#set: common-name=a (3r,7z)-3-hydroxyhexacos-7-enoyl-[acp]}}
{{#set: molecular-weight=971.802}}
 
{{#set: inchi-key=inchikey=fdxhxlpclxeysu-dxazuofzsa-j}}
 

Revision as of 17:58, 13 January 2021

Metabolite cis-delta7-3-hydroxycerotoyl-ACPs

  • common-name:
    • a (3r,7z)-3-hydroxyhexacos-7-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r,7z)-3-hydroxyhexacos-7-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.