Difference between revisions of "ADP-D-GLUCOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD66-39 == * common-name: ** a 2,3,4-saturated fatty acid == Reaction(s) known to consume the compound == * ACYLCOASYN-RXN * TRANS...")
 
(Created page with "Category:metabolite == Metabolite ADP-D-GLUCOSE == * common-name: ** adp-α-d-glucose * molecular-weight: ** 587.33 * inchi-key: ** wfpzsxyxpsuopy-roywqjlosa-l * smil...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD66-39 ==
+
== Metabolite ADP-D-GLUCOSE ==
 
* common-name:
 
* common-name:
** a 2,3,4-saturated fatty acid
+
** adp-α-d-glucose
 +
* molecular-weight:
 +
** 587.33
 +
* inchi-key:
 +
** wfpzsxyxpsuopy-roywqjlosa-l
 +
* smiles:
 +
** c(c1(c(c(c(c(o1)op(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))(=o)[o-])(=o)[o-])o)o)o))o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACYLCOASYN-RXN]]
 
* [[TRANS-RXN0-623]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GLUC1PADENYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2,3,4-saturated fatty acid}}
+
{{#set: common-name=adp-α-d-glucose}}
 +
{{#set: molecular-weight=587.33}}
 +
{{#set: inchi-key=inchikey=wfpzsxyxpsuopy-roywqjlosa-l}}

Latest revision as of 19:34, 17 March 2021

Metabolite ADP-D-GLUCOSE

  • common-name:
    • adp-α-d-glucose
  • molecular-weight:
    • 587.33
  • inchi-key:
    • wfpzsxyxpsuopy-roywqjlosa-l
  • smiles:
    • c(c1(c(c(c(c(o1)op(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))(=o)[o-])(=o)[o-])o)o)o))o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality