Difference between revisions of "ALPHA-D-MANNOSYLCHITOBIO"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HCO3 == * common-name: ** hydrogencarbonate * molecular-weight: ** 61.017 * inchi-key: ** bvkzguzccusvtd-uhfffaoysa-m * smiles: ** c([o-]...") |
(Created page with "Category:metabolite == Metabolite CPD1F-118 == * common-name: ** α-carotene * molecular-weight: ** 536.882 * inchi-key: ** anvaowxlwrtkga-ntxluargsa-n * smiles: ** c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1F-118 == |
* common-name: | * common-name: | ||
| − | ** | + | ** α-carotene |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 536.882 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** anvaowxlwrtkga-ntxluargsa-n |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))=cc=cc=c(c)c=cc=c(c)c=cc2(c(c)(c)cccc(c)=2) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1F-148]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-carotene}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=536.882}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=anvaowxlwrtkga-ntxluargsa-n}} |
Revision as of 18:58, 17 March 2021
Contents
Metabolite CPD1F-118
- common-name:
- α-carotene
- molecular-weight:
- 536.882
- inchi-key:
- anvaowxlwrtkga-ntxluargsa-n
- smiles:
- cc(c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))=cc=cc=c(c)c=cc=c(c)c=cc2(c(c)(c)cccc(c)=2)
