Difference between revisions of "ALPHA-GLUCOSE-16-BISPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Alpha-tubulins == * common-name: ** α-tubulin == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...") |
(Created page with "Category:metabolite == Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE == * common-name: ** α-glucose 1,6-bisphosphate * molecular-weight: ** 336.085 * inchi-key: ** rwhozg...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** α- | + | ** α-glucose 1,6-bisphosphate |
| + | * molecular-weight: | ||
| + | ** 336.085 | ||
| + | * inchi-key: | ||
| + | ** rwhozgraxywrnx-vfuothlcsa-j | ||
| + | * smiles: | ||
| + | ** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-]) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GLUCOSE-16-BISPHOSPHATE-SYNTHASE-RXN]] | ||
| + | * [[RXN-16998]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GLUCOSE-16-BISPHOSPHATE-SYNTHASE-RXN]] |
| + | * [[RXN-16997]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=α- | + | {{#set: common-name=α-glucose 1,6-bisphosphate}} |
| + | {{#set: molecular-weight=336.085}} | ||
| + | {{#set: inchi-key=inchikey=rwhozgraxywrnx-vfuothlcsa-j}} | ||
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE
- common-name:
- α-glucose 1,6-bisphosphate
- molecular-weight:
- 336.085
- inchi-key:
- rwhozgraxywrnx-vfuothlcsa-j
- smiles:
- c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-])
