Difference between revisions of "ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite NIACINAMIDE == * common-name: ** nicotinamide * molecular-weight: ** 122.126 * inchi-key: ** dfpaksucgfbddf-uhfffaoysa-n * smiles: ** c1(...") |
(Created page with "Category:metabolite == Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE == * common-name: ** (r)-4'-phosphopantothenoyl-l-cysteine * molecular-weight: ** 399.332 * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-4'-phosphopantothenoyl-l-cysteine |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 399.332 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xqyalqvlcnhcft-cbapkceasa-k |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)(cop(=o)([o-])[o-])c(o)c(=o)nccc(=o)nc(cs)c(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[P-PANTOCYSDECARB-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-4'-phosphopantothenoyl-l-cysteine}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=399.332}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xqyalqvlcnhcft-cbapkceasa-k}} |
Revision as of 19:02, 17 March 2021
Contents
Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE
- common-name:
- (r)-4'-phosphopantothenoyl-l-cysteine
- molecular-weight:
- 399.332
- inchi-key:
- xqyalqvlcnhcft-cbapkceasa-k
- smiles:
- cc(c)(cop(=o)([o-])[o-])c(o)c(=o)nccc(=o)nc(cs)c(=o)[o-]
