Difference between revisions of "ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALTOTETRAOSE == * common-name: ** maltotetraose * molecular-weight: ** 666.583 * inchi-key: ** luewuzlmquobsb-ayqjavfrsa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER == * common-name: ** an n-acetyl-α-neuraminyl-(2→3)-β-d-galactosyl-(1→4)-n-...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MALTOTETRAOSE ==
+
== Metabolite ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER ==
 
* common-name:
 
* common-name:
** maltotetraose
+
** an n-acetyl-α-neuraminyl-(2→3)-β-d-galactosyl-(1→4)-n-acetyl-β-d-glucosaminyl-r
* molecular-weight:
 
** 666.583
 
* inchi-key:
 
** luewuzlmquobsb-ayqjavfrsa-n
 
* smiles:
 
** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5182]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYMALTOPHOSPHORYL-RXN]]
+
* [[2.4.99.6-RXN]]
* [[RXN-14284]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltotetraose}}
+
{{#set: common-name=an n-acetyl-α-neuraminyl-(2→3)-β-d-galactosyl-(1→4)-n-acetyl-β-d-glucosaminyl-r}}
{{#set: molecular-weight=666.583}}
 
{{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER

  • common-name:
    • an n-acetyl-α-neuraminyl-(2→3)-β-d-galactosyl-(1→4)-n-acetyl-β-d-glucosaminyl-r

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality