Difference between revisions of "ALPHA-TOCOPHEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HOMO-CIS-ACONITATE == * common_name: ** cis-homoaconitate * smiles: ** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-] * inchi_key: ** inchikey=bjyp...") |
(Created page with "Category:metabolite == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == * common-name: ** 6-phospho d-glucono-1,5-lactone * molecular-weight: ** 256.105 * inchi-key: ** ijojivndf...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == |
| − | * | + | * common-name: |
| − | ** | + | ** 6-phospho d-glucono-1,5-lactone |
| + | * molecular-weight: | ||
| + | ** 256.105 | ||
| + | * inchi-key: | ||
| + | ** ijojivndfqsgab-sqougzdysa-l | ||
* smiles: | * smiles: | ||
| − | ** c(=o) | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1) |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[6PGLUCONOLACT-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GLU6PDEHYDROG-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=6-phospho d-glucono-1,5-lactone}} |
| − | {{#set: | + | {{#set: molecular-weight=256.105}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=ijojivndfqsgab-sqougzdysa-l}} |
Revision as of 17:56, 13 January 2021
Contents
Metabolite D-6-P-GLUCONO-DELTA-LACTONE
- common-name:
- 6-phospho d-glucono-1,5-lactone
- molecular-weight:
- 256.105
- inchi-key:
- ijojivndfqsgab-sqougzdysa-l
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
