Difference between revisions of "AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LysW-L-glutamate-5-semialdehyde == * common-name: ** a [lysine-biosynthesis-protein lysw]-c-terminal-γ-(l-glutamate 5-semialdehyde-...") |
(Created page with "Category:metabolite == Metabolite CPD-8999 == * common-name: ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate * molecular-weight: ** 240.167 * inchi-key: ** hkeaovfnwrdva...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8999 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate |
| + | * molecular-weight: | ||
| + | ** 240.167 | ||
| + | * inchi-key: | ||
| + | ** hkeaovfnwrdvaj-uhfffaoysa-l | ||
| + | * smiles: | ||
| + | ** csccc(=o)c(=o)cop([o-])(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[3.1.3.77-RXN]] |
| + | * [[R82-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[R145-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate}} |
| + | {{#set: molecular-weight=240.167}} | ||
| + | {{#set: inchi-key=inchikey=hkeaovfnwrdvaj-uhfffaoysa-l}} | ||
Revision as of 15:06, 15 March 2021
Contents
Metabolite CPD-8999
- common-name:
- 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate
- molecular-weight:
- 240.167
- inchi-key:
- hkeaovfnwrdvaj-uhfffaoysa-l
- smiles:
- csccc(=o)c(=o)cop([o-])(=o)[o-]
