Difference between revisions of "AMINOMETHYLDIHYDROLIPOYL-GCVH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-SEROTONIN == * common-name: ** n-acetyl-serotonin * molecular-weight: ** 218.255 * inchi-key: ** mvawjsidnickhf-uhfffaoysa-n * s...")
(Created page with "Category:metabolite == Metabolite AMINOMETHYLDIHYDROLIPOYL-GCVH == * common-name: ** a [glycine-cleavage complex h protein] n6-aminomethyldihydrolipoyl-l-lysine == Reactio...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-ACETYL-SEROTONIN ==
+
== Metabolite AMINOMETHYLDIHYDROLIPOYL-GCVH ==
 
* common-name:
 
* common-name:
** n-acetyl-serotonin
+
** a [glycine-cleavage complex h protein] n6-aminomethyldihydrolipoyl-l-lysine
* molecular-weight:
 
** 218.255
 
* inchi-key:
 
** mvawjsidnickhf-uhfffaoysa-n
 
* smiles:
 
** cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11059]]
+
* [[GCVP-RXN]]
* [[RXN-11060]]
+
* [[GCVT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GCVP-RXN]]
 +
* [[GCVT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-serotonin}}
+
{{#set: common-name=a [glycine-cleavage complex h protein] n6-aminomethyldihydrolipoyl-l-lysine}}
{{#set: molecular-weight=218.255}}
 
{{#set: inchi-key=inchikey=mvawjsidnickhf-uhfffaoysa-n}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite AMINOMETHYLDIHYDROLIPOYL-GCVH

  • common-name:
    • a [glycine-cleavage complex h protein] n6-aminomethyldihydrolipoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycine-cleavage complex h protein] n6-aminomethyldihydrolipoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.