Difference between revisions of "AMMONIA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DTDP-RHAMNOSE == * common-name: ** dtdp-β-l-rhamnose * molecular-weight: ** 546.317 * inchi-key: ** zosqfdvxnqfkby-cgaxjhmrsa-l * sm...")
(Created page with "Category:metabolite == Metabolite AMMONIA == * common-name: ** ammonia * molecular-weight: ** 17.03 * inchi-key: ** qgzkdvfqnngyky-uhfffaoysa-n * smiles: ** [nh3] == React...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DTDP-RHAMNOSE ==
+
== Metabolite AMMONIA ==
 
* common-name:
 
* common-name:
** dtdp-β-l-rhamnose
+
** ammonia
 
* molecular-weight:
 
* molecular-weight:
** 546.317
+
** 17.03
 
* inchi-key:
 
* inchi-key:
** zosqfdvxnqfkby-cgaxjhmrsa-l
+
** qgzkdvfqnngyky-uhfffaoysa-n
 
* smiles:
 
* smiles:
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3))
+
** [nh3]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DTDPDEHYRHAMREDUCT-RXN]]
+
* [[ExchangeSeed-AMMONIA]]
* [[DTDPRHAMSYNTHMULTI-RXN]]
+
* [[RXN-11811]]
 +
* [[TransportSeed-AMMONIA]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DTDPDEHYRHAMREDUCT-RXN]]
+
* [[ExchangeSeed-AMMONIA]]
* [[DTDPRHAMSYNTHMULTI-RXN]]
+
* [[RXN-11811]]
 +
* [[RXN-17130]]
 +
* [[TransportSeed-AMMONIA]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dtdp-β-l-rhamnose}}
+
{{#set: common-name=ammonia}}
{{#set: molecular-weight=546.317}}
+
{{#set: molecular-weight=17.03}}
{{#set: inchi-key=inchikey=zosqfdvxnqfkby-cgaxjhmrsa-l}}
+
{{#set: inchi-key=inchikey=qgzkdvfqnngyky-uhfffaoysa-n}}

Latest revision as of 19:34, 17 March 2021

Metabolite AMMONIA

  • common-name:
    • ammonia
  • molecular-weight:
    • 17.03
  • inchi-key:
    • qgzkdvfqnngyky-uhfffaoysa-n
  • smiles:
    • [nh3]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality