Difference between revisions of "AMMONIUM"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-METHYLTHIOADENOSINE == * common-name: ** s-methyl-5'-thioadenosine * molecular-weight: ** 297.331 * inchi-key: ** wuugfsxjnotrmr-ioslpc...")
(Created page with "Category:metabolite == Metabolite AMMONIUM == * common-name: ** ammonium * molecular-weight: ** 18.038 * inchi-key: ** qgzkdvfqnngyky-uhfffaoysa-o * smiles: ** [nh4+] == R...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 5-METHYLTHIOADENOSINE ==
+
== Metabolite AMMONIUM ==
 
* common-name:
 
* common-name:
−
** s-methyl-5'-thioadenosine
+
** ammonium
 
* molecular-weight:
 
* molecular-weight:
−
** 297.331
+
** 18.038
 
* inchi-key:
 
* inchi-key:
−
** wuugfsxjnotrmr-ioslpcccsa-n
+
** qgzkdvfqnngyky-uhfffaoysa-o
 
* smiles:
 
* smiles:
−
** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
+
** [nh4+]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]]
+
* [[4.3.1.16-RXN]]
−
* [[RXN-11190]]
+
* [[ASNSYNA-RXN]]
−
* [[SPERMIDINESYN-RXN]]
+
* [[GCVMULTI-RXN]]
 +
* [[GCVMULTI-RXN-GLY/THF/NAD//METHYLENE-THF/AMMONIUM/CARBON-DIOXIDE/NADH.56.]]
 +
* [[GCVT-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[GLUTAMINESYN-RXN]]
 +
* [[GLUTAMINYL-PEPTIDE-CYCLOTRANSFERASE-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GMP-SYN-NH3-RXN]]
 +
* [[NAD-SYNTH-NH3-RXN]]
 +
* [[OMEGA-AMIDASE-RXN]]
 +
* [[RXN-11811]]
 +
* [[RXN-13202]]
 +
* [[RXN-14325]]
 +
* [[RXN-16910]]
 +
* [[RXN-9615]]
 +
* [[UREASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[4.4.1.14-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* [[RXN-11190]]
+
* [[2.3.2.13-RXN]]
−
* [[RXN0-5217]]
+
* [[4.3.1.16-RXN]]
−
* [[SPERMIDINESYN-RXN]]
+
* [[4.3.1.17-RXN]]
 +
* [[ADDALT-RXN]]
 +
* [[ADENODEAMIN-RXN]]
 +
* [[AGMATINE-DEIMINASE-RXN]]
 +
* [[AMACETOXID-RXN]]
 +
* [[AMINEOXID-RXN]]
 +
* [[AMINEPHEN-RXN]]
 +
* [[AMP-DEAMINASE-RXN]]
 +
* [[ARG-OXIDATION-RXN]]
 +
* [[ASPARAGHYD-RXN]]
 +
* [[BETA-UREIDOPROPIONASE-RXN]]
 +
* [[CYSTATHIONINE-BETA-LYASE-RXN]]
 +
* [[CYSTHIOCYS-RXN]]
 +
* [[CYTIDEAM-RXN]]
 +
* [[CYTIDEAM2-RXN]]
 +
* [[DCMP-DEAMINASE-RXN]]
 +
* [[DSERDEAM-RXN]]
 +
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
 +
* [[GCVMULTI-RXN]]
 +
* [[GCVMULTI-RXN-GLY/THF/NAD//METHYLENE-THF/AMMONIUM/CARBON-DIOXIDE/NADH.56.]]
 +
* [[GCVT-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 +
* [[GLUTAMIN-RXN]]
 +
* [[GLUTAMINYL-PEPTIDE-CYCLOTRANSFERASE-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GUANINE-DEAMINASE-RXN]]
 +
* [[HOMOSERDEAM-RXN]]
 +
* [[L-AMINO-ACID-OXIDASE-RXN]]
 +
* [[L-LYSINE-OXIDASE-RXN]]
 +
* [[LCYSDESULF-RXN]]
 +
* [[METBALT-RXN]]
 +
* [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]]
 +
* [[OHMETHYLBILANESYN-RXN]]
 +
* [[OMEGA-AMIDASE-RXN]]
 +
* [[PMPOXI-RXN]]
 +
* [[PROTEIN-ARGININE-DEIMINASE-RXN]]
 +
* [[RIBOFLAVINSYNDEAM-RXN]]
 +
* [[RXN-10058]]
 +
* [[RXN-11210]]
 +
* [[RXN-11784]]
 +
* [[RXN-11811]]
 +
* [[RXN-12729]]
 +
* [[RXN-12878]]
 +
* [[RXN-1404]]
 +
* [[RXN-15123]]
 +
* [[RXN-15127]]
 +
* [[RXN-15130]]
 +
* [[RXN-15261]]
 +
* [[RXN-5821]]
 +
* [[RXN-6381]]
 +
* [[RXN-646]]
 +
* [[RXN-8098]]
 +
* [[RXN-8244]]
 +
* [[RXN-8899]]
 +
* [[RXN-9597]]
 +
* [[RXN-9599]]
 +
* [[RXN-9600]]
 +
* [[RXN-9615]]
 +
* [[RXN0-5222]]
 +
* [[RXN0-6377]]
 +
* [[RXN6666-4]]
 +
* [[THREDEHYD-RXN]]
 +
* [[UREASE-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=s-methyl-5'-thioadenosine}}
+
{{#set: common-name=ammonium}}
−
{{#set: molecular-weight=297.331}}
+
{{#set: molecular-weight=18.038}}
−
{{#set: inchi-key=inchikey=wuugfsxjnotrmr-ioslpcccsa-n}}
+
{{#set: inchi-key=inchikey=qgzkdvfqnngyky-uhfffaoysa-o}}

Latest revision as of 19:35, 17 March 2021

Metabolite AMMONIUM

  • common-name:
    • ammonium
  • molecular-weight:
    • 18.038
  • inchi-key:
    • qgzkdvfqnngyky-uhfffaoysa-o
  • smiles:
    • [nh4+]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=AMMONIUM&oldid=49286"