Difference between revisions of "AN-ALPHA-L-FUCOSIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Phosphoserines == * common-name: ** l(or d)-o-phosphoserine == Reaction(s) known to consume the compound == * PSERPHOSPHA-RXN == Reac...") |
(Created page with "Category:metabolite == Metabolite RIBOFLAVIN == * common-name: ** riboflavin * molecular-weight: ** 375.36 * inchi-key: ** aunganrzjhbgpy-scrdcrapsa-m * smiles: ** cc1(c=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RIBOFLAVIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** riboflavin |
| + | * molecular-weight: | ||
| + | ** 375.36 | ||
| + | * inchi-key: | ||
| + | ** aunganrzjhbgpy-scrdcrapsa-m | ||
| + | * smiles: | ||
| + | ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[NADPH-DEHYDROGENASE-FLAVIN-RXN]] |
| + | * [[RIBOFLAVINKIN-RXN]] | ||
| + | * [[RXN-12445]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RIBOFLAVIN-SYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=riboflavin}} |
| + | {{#set: molecular-weight=375.36}} | ||
| + | {{#set: inchi-key=inchikey=aunganrzjhbgpy-scrdcrapsa-m}} | ||
Revision as of 19:02, 17 March 2021
Contents
Metabolite RIBOFLAVIN
- common-name:
- riboflavin
- molecular-weight:
- 375.36
- inchi-key:
- aunganrzjhbgpy-scrdcrapsa-m
- smiles:
- cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3)))
