Difference between revisions of "AN-ALPHA-L-FUCOSIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RIBOFLAVIN == * common-name: ** riboflavin * molecular-weight: ** 375.36 * inchi-key: ** aunganrzjhbgpy-scrdcrapsa-m * smiles: ** cc1(c=c...")
(Created page with "Category:metabolite == Metabolite AN-ALPHA-L-FUCOSIDE == * common-name: ** α-l-fucoside * smiles: ** cc1(oc(o[r])c(o)c(o)c(o)1) == Reaction(s) known to consume the c...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RIBOFLAVIN ==
+
== Metabolite AN-ALPHA-L-FUCOSIDE ==
 
* common-name:
 
* common-name:
** riboflavin
+
** α-l-fucoside
* molecular-weight:
 
** 375.36
 
* inchi-key:
 
** aunganrzjhbgpy-scrdcrapsa-m
 
 
* smiles:
 
* smiles:
** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3)))
+
** cc1(oc(o[r])c(o)c(o)c(o)1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
+
* [[ALPHA-L-FUCOSIDASE-RXN]]
* [[RIBOFLAVINKIN-RXN]]
 
* [[RXN-12445]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RIBOFLAVIN-SYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=riboflavin}}
+
{{#set: common-name=α-l-fucoside}}
{{#set: molecular-weight=375.36}}
 
{{#set: inchi-key=inchikey=aunganrzjhbgpy-scrdcrapsa-m}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite AN-ALPHA-L-FUCOSIDE

  • common-name:
    • α-l-fucoside
  • smiles:
    • cc1(oc(o[r])c(o)c(o)c(o)1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality