Difference between revisions of "APS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Deoxy-Ribonucleoside-Diphosphates == * common-name: ** a 2'-deoxyribonucleoside 5'-diphosphate == Reaction(s) known to consume the compou...") |
(Created page with "Category:metabolite == Metabolite CPD-9646 == * common-name: ** di-trans,octa-cis-undecaprenyl phosphate * molecular-weight: ** 845.279 * inchi-key: ** ufphfkctoziafy-ntdv...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-9646 == |
* common-name: | * common-name: | ||
− | ** | + | ** di-trans,octa-cis-undecaprenyl phosphate |
+ | * molecular-weight: | ||
+ | ** 845.279 | ||
+ | * inchi-key: | ||
+ | ** ufphfkctoziafy-ntdveaecsa-l | ||
+ | * smiles: | ||
+ | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])[o-])c)c)c | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[PHOSNACMURPENTATRANS-RXN]] | ||
+ | * [[RXN-11347]] | ||
+ | * [[RXN-8975]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-8975]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=di-trans,octa-cis-undecaprenyl phosphate}} |
+ | {{#set: molecular-weight=845.279}} | ||
+ | {{#set: inchi-key=inchikey=ufphfkctoziafy-ntdveaecsa-l}} |
Revision as of 17:52, 13 January 2021
Contents
Metabolite CPD-9646
- common-name:
- di-trans,octa-cis-undecaprenyl phosphate
- molecular-weight:
- 845.279
- inchi-key:
- ufphfkctoziafy-ntdveaecsa-l
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])[o-])c)c)c