Difference between revisions of "APS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-KETO-ADIPYL-COA == * common-name: ** 3-oxoadipyl-coa * molecular-weight: ** 904.605 * inchi-key: ** vkkkaapgxhwxoo-biewrjsysa-i * smile...")
(Created page with "Category:metabolite == Metabolite APS == * common-name: ** adenosine 5'-phosphosulfate * molecular-weight: ** 425.266 * inchi-key: ** irlpacmltupbcl-kqynxxcusa-l * smiles:...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-KETO-ADIPYL-COA ==
+
== Metabolite APS ==
 
* common-name:
 
* common-name:
** 3-oxoadipyl-coa
+
** adenosine 5'-phosphosulfate
 
* molecular-weight:
 
* molecular-weight:
** 904.605
+
** 425.266
 
* inchi-key:
 
* inchi-key:
** vkkkaapgxhwxoo-biewrjsysa-i
+
** irlpacmltupbcl-kqynxxcusa-l
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-2044]]
+
* [[ADENYLYLSULFATASE-RXN]]
 +
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[R163-RXN]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-2044]]
+
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[R163-RXN]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxoadipyl-coa}}
+
{{#set: common-name=adenosine 5'-phosphosulfate}}
{{#set: molecular-weight=904.605}}
+
{{#set: molecular-weight=425.266}}
{{#set: inchi-key=inchikey=vkkkaapgxhwxoo-biewrjsysa-i}}
+
{{#set: inchi-key=inchikey=irlpacmltupbcl-kqynxxcusa-l}}

Latest revision as of 19:34, 17 March 2021

Metabolite APS

  • common-name:
    • adenosine 5'-phosphosulfate
  • molecular-weight:
    • 425.266
  • inchi-key:
    • irlpacmltupbcl-kqynxxcusa-l
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality