Difference between revisions of "ASN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSYLCOBINAMIDE == * common-name: ** adenosylcobinamide * molecular-weight: ** 1240.332 * inchi-key: ** kqxspgaebzwhmc-qmuwongrsa-m *...") |
(Created page with "Category:metabolite == Metabolite ASN == * common-name: ** l-asparagine * molecular-weight: ** 132.119 * inchi-key: ** dcxyfedjocdnaf-reohclbhsa-n * smiles: ** c(cc(c(=o)[...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ASN == |
* common-name: | * common-name: | ||
− | ** | + | ** l-asparagine |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 132.119 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** dcxyfedjocdnaf-reohclbhsa-n |
* smiles: | * smiles: | ||
− | ** | + | ** c(cc(c(=o)[o-])[n+])(n)=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ASPARAGHYD-RXN]] | ||
+ | * [[ASPARAGINE--TRNA-LIGASE-RXN]] | ||
+ | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ASNSYNA-RXN]] |
+ | * [[ASNSYNB-RXN]] | ||
+ | * [[RXN-12460]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-asparagine}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=132.119}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}} |
Latest revision as of 19:37, 17 March 2021
Contents
Metabolite ASN
- common-name:
- l-asparagine
- molecular-weight:
- 132.119
- inchi-key:
- dcxyfedjocdnaf-reohclbhsa-n
- smiles:
- c(cc(c(=o)[o-])[n+])(n)=o