Difference between revisions of "Acyl-protein-synthetase"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14928 == * common-name: ** phytenoyl-coa * molecular-weight: ** 1056.006 * inchi-key: ** nyzpdfuazacyot-peaqseffsa-j * smiles: ** cc(...")
 
(Created page with "Category:metabolite == Metabolite Methylated-methyl-acceptors == * common-name: ** a methylated methyl donor == Reaction(s) known to consume the compound == == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-14928 ==
+
== Metabolite Methylated-methyl-acceptors ==
 
* common-name:
 
* common-name:
−
** phytenoyl-coa
+
** a methylated methyl donor
−
* molecular-weight:
 
−
** 1056.006
 
−
* inchi-key:
 
−
** nyzpdfuazacyot-peaqseffsa-j
 
−
* smiles:
 
−
** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN66-482]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN66-480]]
+
* [[RXN-7605]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=phytenoyl-coa}}
+
{{#set: common-name=a methylated methyl donor}}
−
{{#set: molecular-weight=1056.006}}
 
−
{{#set: inchi-key=inchikey=nyzpdfuazacyot-peaqseffsa-j}}
 

Revision as of 17:52, 13 January 2021

Metabolite Methylated-methyl-acceptors

  • common-name:
    • a methylated methyl donor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=Acyl-protein-synthetase&oldid=17452"