Difference between revisions of "Alkyl-Hydro-Peroxides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-196 == * common-name: ** octanoyl-coa * molecular-weight: ** 889.7 * inchi-key: ** kqmzyoxobsxmii-cecatxlmsa-j * smiles: ** cccccccc(...")
(Created page with "Category:metabolite == Metabolite Man8GlcNAc2-protein-A123B13 == * common-name: ** man8glcnac2-[protein] (isomer 8a1,2,3b1,3) == Reaction(s) known to consume the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-196 ==
+
== Metabolite Man8GlcNAc2-protein-A123B13 ==
 
* common-name:
 
* common-name:
** octanoyl-coa
+
** man8glcnac2-[protein] (isomer 8a1,2,3b1,3)
* molecular-weight:
 
** 889.7
 
* inchi-key:
 
** kqmzyoxobsxmii-cecatxlmsa-j
 
* smiles:
 
** cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12669]]
+
* [[2.4.1.232-RXN]]
* [[RXN-14229]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R223-RXN]]
 
* [[RXN-13617]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=octanoyl-coa}}
+
{{#set: common-name=man8glcnac2-[protein] (isomer 8a1,2,3b1,3)}}
{{#set: molecular-weight=889.7}}
 
{{#set: inchi-key=inchikey=kqmzyoxobsxmii-cecatxlmsa-j}}
 

Revision as of 19:03, 17 March 2021

Metabolite Man8GlcNAc2-protein-A123B13

  • common-name:
    • man8glcnac2-[protein] (isomer 8a1,2,3b1,3)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "man8glcnac2-[protein] (isomer 8a1,2,3b1,3)" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.