Difference between revisions of "Alkyl-Hydro-Peroxides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-196 == * common-name: ** octanoyl-coa * molecular-weight: ** 889.7 * inchi-key: ** kqmzyoxobsxmii-cecatxlmsa-j * smiles: ** cccccccc(...")
(Created page with "Category:metabolite == Metabolite Alkyl-Hydro-Peroxides == * common-name: ** an organic hydroperoxide == Reaction(s) known to consume the compound == * 1.11.1.15-RXN =...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-196 ==
+
== Metabolite Alkyl-Hydro-Peroxides ==
 
* common-name:
 
* common-name:
−
** octanoyl-coa
+
** an organic hydroperoxide
−
* molecular-weight:
 
−
** 889.7
 
−
* inchi-key:
 
−
** kqmzyoxobsxmii-cecatxlmsa-j
 
−
* smiles:
 
−
** cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-12669]]
+
* [[1.11.1.15-RXN]]
−
* [[RXN-14229]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[R223-RXN]]
 
−
* [[RXN-13617]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=octanoyl-coa}}
+
{{#set: common-name=an organic hydroperoxide}}
−
{{#set: molecular-weight=889.7}}
 
−
{{#set: inchi-key=inchikey=kqmzyoxobsxmii-cecatxlmsa-j}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite Alkyl-Hydro-Peroxides

  • common-name:
    • an organic hydroperoxide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=Alkyl-Hydro-Peroxides&oldid=49955"