Difference between revisions of "Alkyl-acetyl-glycero-phosphocholines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Alkyl-acetyl-glycero-phosphocholines == * common-name: ** a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine == Reaction(s) known to consume...") |
(Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * molecular-weight: ** 256.257 * inchi-key: ** loyxtwzxlwhmbx-votsokgwsa-n * smiles: *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-6993 == |
* common-name: | * common-name: | ||
− | ** | + | ** pinocembrin chalcone |
+ | * molecular-weight: | ||
+ | ** 256.257 | ||
+ | * inchi-key: | ||
+ | ** loyxtwzxlwhmbx-votsokgwsa-n | ||
+ | * smiles: | ||
+ | ** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7647]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-7645]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pinocembrin chalcone}} |
+ | {{#set: molecular-weight=256.257}} | ||
+ | {{#set: inchi-key=inchikey=loyxtwzxlwhmbx-votsokgwsa-n}} |
Revision as of 15:12, 15 March 2021
Contents
Metabolite CPD-6993
- common-name:
- pinocembrin chalcone
- molecular-weight:
- 256.257
- inchi-key:
- loyxtwzxlwhmbx-votsokgwsa-n
- smiles:
- c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)