Difference between revisions of "Alkyl-acetyl-glycero-phosphocholines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * molecular-weight: ** 256.257 * inchi-key: ** loyxtwzxlwhmbx-votsokgwsa-n * smiles: *...")
(Created page with "Category:metabolite == Metabolite HSO3 == * common-name: ** hydrogensulfite * molecular-weight: ** 81.066 * inchi-key: ** lsnnmfcwukxfee-uhfffaoysa-m * smiles: ** os(=o)[o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6993 ==
+
== Metabolite HSO3 ==
 
* common-name:
 
* common-name:
** pinocembrin chalcone
+
** hydrogensulfite
 
* molecular-weight:
 
* molecular-weight:
** 256.257
+
** 81.066
 
* inchi-key:
 
* inchi-key:
** loyxtwzxlwhmbx-votsokgwsa-n
+
** lsnnmfcwukxfee-uhfffaoysa-m
 
* smiles:
 
* smiles:
** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
+
** os(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7647]]
+
* [[RXN-8315]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7645]]
+
* [[RXN-8315]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pinocembrin chalcone}}
+
{{#set: common-name=hydrogensulfite}}
{{#set: molecular-weight=256.257}}
+
{{#set: molecular-weight=81.066}}
{{#set: inchi-key=inchikey=loyxtwzxlwhmbx-votsokgwsa-n}}
+
{{#set: inchi-key=inchikey=lsnnmfcwukxfee-uhfffaoysa-m}}

Revision as of 19:03, 17 March 2021

Metabolite HSO3

  • common-name:
    • hydrogensulfite
  • molecular-weight:
    • 81.066
  • inchi-key:
    • lsnnmfcwukxfee-uhfffaoysa-m
  • smiles:
    • os(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality