Difference between revisions of "Alkyl-acetyl-glycero-phosphocholines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * molecular-weight: ** 256.257 * inchi-key: ** loyxtwzxlwhmbx-votsokgwsa-n * smiles: *...")
(Created page with "Category:metabolite == Metabolite Alkyl-acetyl-glycero-phosphocholines == * common-name: ** a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine == Reaction(s) known to consume...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6993 ==
+
== Metabolite Alkyl-acetyl-glycero-phosphocholines ==
 
* common-name:
 
* common-name:
** pinocembrin chalcone
+
** a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine
* molecular-weight:
 
** 256.257
 
* inchi-key:
 
** loyxtwzxlwhmbx-votsokgwsa-n
 
* smiles:
 
** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7647]]
+
* [[2.3.1.67-RXN]]
 +
* [[3.1.1.47-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7645]]
+
* [[2.3.1.67-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pinocembrin chalcone}}
+
{{#set: common-name=a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine}}
{{#set: molecular-weight=256.257}}
 
{{#set: inchi-key=inchikey=loyxtwzxlwhmbx-votsokgwsa-n}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite Alkyl-acetyl-glycero-phosphocholines

  • common-name:
    • a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality