Difference between revisions of "Alkyl-acetyl-glycero-phosphocholines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORYL-CHOLINE == * common-name: ** phosphocholine * molecular-weight: ** 182.136 * inchi-key: ** yhhsonzfoiemcp-uhfffaoysa-m * smile...")
 
(Created page with "Category:metabolite == Metabolite Alkyl-acetyl-glycero-phosphocholines == * common-name: ** a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine == Reaction(s) known to consume...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORYL-CHOLINE ==
+
== Metabolite Alkyl-acetyl-glycero-phosphocholines ==
 
* common-name:
 
* common-name:
** phosphocholine
+
** a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine
* molecular-weight:
 
** 182.136
 
* inchi-key:
 
** yhhsonzfoiemcp-uhfffaoysa-m
 
* smiles:
 
** c[n+](ccop([o-])([o-])=o)(c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.15-RXN]]
+
* [[2.3.1.67-RXN]]
* [[RXN-5647]]
+
* [[3.1.1.47-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.3.1.67-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phosphocholine}}
+
{{#set: common-name=a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine}}
{{#set: molecular-weight=182.136}}
 
{{#set: inchi-key=inchikey=yhhsonzfoiemcp-uhfffaoysa-m}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite Alkyl-acetyl-glycero-phosphocholines

  • common-name:
    • a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality