Difference between revisions of "Alkyl-enyl-acyl-gly-P-EtOH-amines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17049 == * common-name: ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine * molecular-weight: ** 298.374 * inchi-key: ** vzg...")
(Created page with "Category:metabolite == Metabolite Alkyl-enyl-acyl-gly-P-EtOH-amines == * common-name: ** a plasmenylethanolamine == Reaction(s) known to consume the compound == * RXN-17...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-17049 ==
+
== Metabolite Alkyl-enyl-acyl-gly-P-EtOH-amines ==
 
* common-name:
 
* common-name:
−
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
+
** a plasmenylethanolamine
−
* molecular-weight:
 
−
** 298.374
 
−
* inchi-key:
 
−
** vzgsjjjqzptkgr-vxgbxaggsa-n
 
−
* smiles:
 
−
** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))nc(=o)2)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-15684]]
+
* [[RXN-17735]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=a plasmenylethanolamine}}
−
{{#set: molecular-weight=298.374}}
 
−
{{#set: inchi-key=inchikey=vzgsjjjqzptkgr-vxgbxaggsa-n}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite Alkyl-enyl-acyl-gly-P-EtOH-amines

  • common-name:
    • a plasmenylethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=Alkyl-enyl-acyl-gly-P-EtOH-amines&oldid=49103"